C14H28N10 — CID 177268244
1-[2-[4-[2-[[(E)-N'-carbamimidoylcarbamimidoyl]amino]ethyl]cyclohex-2-en-1-yl]ethyl]-3-(diaminomethylidene)guanidine (PubChem CID 177268244) has the molecular formula C14H28N10 and a molecular weight of 336.45 g/mol. Its IUPAC name is 1-[2-[4-[2-[[(E)-N'-carbamimidoylcarbamimidoyl]amino]ethyl]cyclohex-2-en-1-yl]ethyl]-3-(diaminomethylidene)guanidine.
| Compound Name | 1-[2-[4-[2-[[(E)-N'-carbamimidoylcarbamimidoyl]amino]ethyl]cyclohex-2-en-1-yl]ethyl]-3-(diaminomethylidene)guanidine |
|---|---|
| PubChem CID | 177268244 |
| Molecular Formula | C14H28N10 |
| Molecular Weight | 336.45 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | 1-[2-[4-[2-[[(E)-N'-carbamimidoylcarbamimidoyl]amino]ethyl]cyclohex-2-en-1-yl]ethyl]-3-(diaminomethylidene)guanidine |
| SMILES | [H]/N=C(\N=C(N)N)NCCC1C=CC(CCN/C(N)=N/C(N)=N/[H])CC1 |
| InChI | InChI=1S/C14H28N10/c15-11(16)23-13(19)21-7-5-9-1-2-10(4-3-9)6-8-22-14(20)24-12(17)18/h1-2,9-10H,3-8H2,(H6,15,16,19,21,23)(H6,17,18,20,22,24) |
| InChIKey | FXHKKWOKNCYKHA-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 200.56 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.45 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|