C19H38ClN3 — CID 11727624
[amino-[2-(cyclohexen-1-yl)ethylamino]methylidene]-(3,7-dimethyloctyl)azanium chloride (PubChem CID 11727624) has the molecular formula C19H38ClN3 and a molecular weight of 343.99 g/mol. Its IUPAC name is [amino-[2-(cyclohexen-1-yl)ethylamino]methylidene]-(3,7-dimethyloctyl)azanium chloride.
| Compound Name | [amino-[2-(cyclohexen-1-yl)ethylamino]methylidene]-(3,7-dimethyloctyl)azanium chloride |
|---|---|
| PubChem CID | 11727624 |
| Molecular Formula | C19H38ClN3 |
| Molecular Weight | 343.99 g/mol |
| Exact Mass | 343.28 |
| IUPAC Name | [amino-[2-(cyclohexen-1-yl)ethylamino]methylidene]-(3,7-dimethyloctyl)azanium chloride |
| SMILES | CC(C)CCCC(C)CC/[NH+]=C(\N)NCCC1=CCCCC1.[Cl-] |
| InChI | InChI=1S/C19H37N3.ClH/c1-16(2)8-7-9-17(3)12-14-21-19(20)22-15-13-18-10-5-4-6-11-18;/h10,16-17H,4-9,11-15H2,1-3H3,(H3,20,21,22);1H |
| InChIKey | HXUXPINSGJUYDB-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 52.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.99 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|