C11H19N3 — CID 103277924
5-(3,5-dimethylcyclohex-3-en-1-yl)-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 103277924) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is 5-(3,5-dimethylcyclohex-3-en-1-yl)-4,5-dihydro-1H-imidazol-2-amine.
| Compound Name | 5-(3,5-dimethylcyclohex-3-en-1-yl)-4,5-dihydro-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 103277924 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 5-(3,5-dimethylcyclohex-3-en-1-yl)-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | CC1=CC(C)CC(C2CN=C(N)N2)C1 |
| InChI | InChI=1S/C11H19N3/c1-7-3-8(2)5-9(4-7)10-6-13-11(12)14-10/h3,7,9-10H,4-6H2,1-2H3,(H3,12,13,14) |
| InChIKey | KZRAVXVDMXJLTK-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|