C83H149NO6 — CID 177270063
bis[(6E,9E,28E,31E)-heptatriaconta-6,9,28,31-tetraen-19-yl] 2-[2-(2-hydroxyethoxy)ethylamino]pentanedioate (PubChem CID 177270063) has the molecular formula C83H149NO6 and a molecular weight of 1257.11 g/mol. Its IUPAC name is bis[(6E,9E,28E,31E)-heptatriaconta-6,9,28,31-tetraen-19-yl] 2-[2-(2-hydroxyethoxy)ethylamino]pentanedioate.
| Compound Name | bis[(6E,9E,28E,31E)-heptatriaconta-6,9,28,31-tetraen-19-yl] 2-[2-(2-hydroxyethoxy)ethylamino]pentanedioate |
|---|---|
| PubChem CID | 177270063 |
| Molecular Formula | C83H149NO6 |
| Molecular Weight | 1257.11 g/mol |
| Exact Mass | 1256.14 |
| IUPAC Name | bis[(6E,9E,28E,31E)-heptatriaconta-6,9,28,31-tetraen-19-yl] 2-[2-(2-hydroxyethoxy)ethylamino]pentanedioate |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCCCC(CCCCCCCC/C=C/C/C=C/CCCCC)OC(=O)CCC(NCCOCCO)C(=O)OC(CCCCCCCC/C=C/C/C=C/CCCCC)CCCCCCCC/C=C/C/C=C/CCCCC |
| InChI | InChI=1S/C83H149NO6/c1-5-9-13-17-21-25-29-33-37-41-45-49-53-57-61-65-69-79(70-66-62-58-54-50-46-42-38-34-30-26-22-18-14-10-6-2)89-82(86)74-73-81(84-75-77-88-78-76-85)83(87)90-80(71-67-63-59-55-51-47-43-39-35-31-27-23-19-15-11-7-3)72-68-64-60-56-52-48-44-40-36-32-28-24-20-16-12-8-4/h21-28,33-40,79-81,84-85H,5-20,29-32,41-78H2,1-4H3/b25-21+,26-22+,27-23+,28-24+,37-33+,38-34+,39-35+,40-36+ |
| InChIKey | FMHAMUVLKQHYBH-VFCGWICASA-N |
| XLogP | 25.37 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 72 |
| Heavy Atoms | 90 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1257.11 |
| LogP ≤ 5 | 25.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|