C13H25N3 — CID 177282371
N-tert-butyl-1-[(E)-hex-3-enyl]-4,5-dihydroimidazol-2-amine (PubChem CID 177282371) has the molecular formula C13H25N3 and a molecular weight of 223.36 g/mol. Its IUPAC name is N-tert-butyl-1-[(E)-hex-3-enyl]-4,5-dihydroimidazol-2-amine.
| Compound Name | N-tert-butyl-1-[(E)-hex-3-enyl]-4,5-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 177282371 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | N-tert-butyl-1-[(E)-hex-3-enyl]-4,5-dihydroimidazol-2-amine |
| SMILES | CC/C=C/CCN1CCN=C1NC(C)(C)C |
| InChI | InChI=1S/C13H25N3/c1-5-6-7-8-10-16-11-9-14-12(16)15-13(2,3)4/h6-7H,5,8-11H2,1-4H3,(H,14,15)/b7-6+ |
| InChIKey | XXXIYYDUABDGDI-VOTSOKGWSA-N |
| XLogP | 2.40 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|