C18H34N3+ — CID 176863785
N-tert-butyl-N-methyl-1,3-bis[(E)-pent-2-enyl]-4,5-dihydroimidazol-1-ium-2-amine (PubChem CID 176863785) has the molecular formula C18H34N3+ and a molecular weight of 292.49 g/mol. Its IUPAC name is N-tert-butyl-N-methyl-1,3-bis[(E)-pent-2-enyl]-4,5-dihydroimidazol-1-ium-2-amine.
| Compound Name | N-tert-butyl-N-methyl-1,3-bis[(E)-pent-2-enyl]-4,5-dihydroimidazol-1-ium-2-amine |
|---|---|
| PubChem CID | 176863785 |
| Molecular Formula | C18H34N3+ |
| Molecular Weight | 292.49 g/mol |
| Exact Mass | 292.27 |
| IUPAC Name | N-tert-butyl-N-methyl-1,3-bis[(E)-pent-2-enyl]-4,5-dihydroimidazol-1-ium-2-amine |
| SMILES | CC/C=C/CN1CC[N+](C/C=C/CC)=C1N(C)C(C)(C)C |
| InChI | InChI=1S/C18H34N3/c1-7-9-11-13-20-15-16-21(14-12-10-8-2)17(20)19(6)18(3,4)5/h9-12H,7-8,13-16H2,1-6H3/q+1/b11-9+,12-10+ |
| InChIKey | DFLMNYXCSPBGCB-WGDLNXRISA-N |
| XLogP | 3.33 |
| TPSA | 9.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.49 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|