C32H30FN7O4S — CID 177282603
2-[3-[[1-[3-cyano-4-(4-cyano-3-fluorophenyl)-5-(3-hydroxy-4-methoxyphenyl)-2-pyridinyl]piperidin-4-yl]amino]propyl]-N-hydroxy-1,3-thiazole-5-carboxamide (PubChem CID 177282603) has the molecular formula C32H30FN7O4S and a molecular weight of 627.70 g/mol. Its IUPAC name is 2-[3-[[1-[3-cyano-4-(4-cyano-3-fluorophenyl)-5-(3-hydroxy-4-methoxyphenyl)-2-pyridinyl]piperidin-4-yl]amino]propyl]-N-hydroxy-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[3-[[1-[3-cyano-4-(4-cyano-3-fluorophenyl)-5-(3-hydroxy-4-methoxyphenyl)-2-pyridinyl]piperidin-4-yl]amino]propyl]-N-hydroxy-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 177282603 |
| Molecular Formula | C32H30FN7O4S |
| Molecular Weight | 627.70 g/mol |
| Exact Mass | 627.21 |
| IUPAC Name | 2-[3-[[1-[3-cyano-4-(4-cyano-3-fluorophenyl)-5-(3-hydroxy-4-methoxyphenyl)-2-pyridinyl]piperidin-4-yl]amino]propyl]-N-hydroxy-1,3-thiazole-5-carboxamide |
| SMILES | COc1ccc(-c2cnc(N3CCC(NCCCc4ncc(C(=O)NO)s4)CC3)c(C#N)c2-c2ccc(C#N)c(F)c2)cc1O |
| InChI | InChI=1S/C32H30FN7O4S/c1-44-27-7-6-19(14-26(27)41)24-17-38-31(23(16-35)30(24)20-4-5-21(15-34)25(33)13-20)40-11-8-22(9-12-40)36-10-2-3-29-37-18-28(45-29)32(42)39-43/h4-7,13-14,17-18,22,36,41,43H,2-3,8-12H2,1H3,(H,39,42) |
| InChIKey | IJIUCUSMQWXDFW-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 167.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.70 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|