C35H28F4N6O4 — CID 177282644
(E)-3-[4-[[[1-[3-cyano-4-(4-cyano-3-fluorophenyl)-5-[3-hydroxy-4-(trifluoromethoxy)phenyl]-2-pyridinyl]piperidin-4-yl]amino]methyl]phenyl]-N-hydroxyprop-2-enamide (PubChem CID 177282644) has the molecular formula C35H28F4N6O4 and a molecular weight of 672.64 g/mol. Its IUPAC name is (E)-3-[4-[[[1-[3-cyano-4-(4-cyano-3-fluorophenyl)-5-[3-hydroxy-4-(trifluoromethoxy)phenyl]-2-pyridinyl]piperidin-4-yl]amino]methyl]phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[4-[[[1-[3-cyano-4-(4-cyano-3-fluorophenyl)-5-[3-hydroxy-4-(trifluoromethoxy)phenyl]-2-pyridinyl]piperidin-4-yl]amino]methyl]phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 177282644 |
| Molecular Formula | C35H28F4N6O4 |
| Molecular Weight | 672.64 g/mol |
| Exact Mass | 672.21 |
| IUPAC Name | (E)-3-[4-[[[1-[3-cyano-4-(4-cyano-3-fluorophenyl)-5-[3-hydroxy-4-(trifluoromethoxy)phenyl]-2-pyridinyl]piperidin-4-yl]amino]methyl]phenyl]-N-hydroxyprop-2-enamide |
| SMILES | N#Cc1ccc(-c2c(-c3ccc(OC(F)(F)F)c(O)c3)cnc(N3CCC(NCc4ccc(/C=C/C(=O)NO)cc4)CC3)c2C#N)cc1F |
| InChI | InChI=1S/C35H28F4N6O4/c36-29-15-24(6-7-25(29)17-40)33-27(18-41)34(43-20-28(33)23-8-9-31(30(46)16-23)49-35(37,38)39)45-13-11-26(12-14-45)42-19-22-3-1-21(2-4-22)5-10-32(47)44-48/h1-10,15-16,20,26,42,46,48H,11-14,19H2,(H,44,47)/b10-5+ |
| InChIKey | XXNBWGMYBZLSFN-BJMVGYQFSA-N |
| XLogP | 6.18 |
| TPSA | 154.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.64 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|