C34H29F2N7O3 — CID 177282487
(E)-3-[4-[[[1-[5-(5-cyano-2-fluoro-4-methoxyphenyl)-4-(6-cyano-3-pyridinyl)-3-fluoro-2-pyridinyl]piperidin-4-yl]amino]methyl]phenyl]-N-hydroxyprop-2-enamide (PubChem CID 177282487) has the molecular formula C34H29F2N7O3 and a molecular weight of 621.65 g/mol. Its IUPAC name is (E)-3-[4-[[[1-[5-(5-cyano-2-fluoro-4-methoxyphenyl)-4-(6-cyano-3-pyridinyl)-3-fluoro-2-pyridinyl]piperidin-4-yl]amino]methyl]phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[4-[[[1-[5-(5-cyano-2-fluoro-4-methoxyphenyl)-4-(6-cyano-3-pyridinyl)-3-fluoro-2-pyridinyl]piperidin-4-yl]amino]methyl]phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 177282487 |
| Molecular Formula | C34H29F2N7O3 |
| Molecular Weight | 621.65 g/mol |
| Exact Mass | 621.23 |
| IUPAC Name | (E)-3-[4-[[[1-[5-(5-cyano-2-fluoro-4-methoxyphenyl)-4-(6-cyano-3-pyridinyl)-3-fluoro-2-pyridinyl]piperidin-4-yl]amino]methyl]phenyl]-N-hydroxyprop-2-enamide |
| SMILES | COc1cc(F)c(-c2cnc(N3CCC(NCc4ccc(/C=C/C(=O)NO)cc4)CC3)c(F)c2-c2ccc(C#N)nc2)cc1C#N |
| InChI | InChI=1S/C34H29F2N7O3/c1-46-30-15-29(35)27(14-24(30)16-37)28-20-41-34(33(36)32(28)23-7-8-26(17-38)40-19-23)43-12-10-25(11-13-43)39-18-22-4-2-21(3-5-22)6-9-31(44)42-45/h2-9,14-15,19-20,25,39,45H,10-13,18H2,1H3,(H,42,44)/b9-6+ |
| InChIKey | CAHUKUYWGUAPEI-RMKNXTFCSA-N |
| XLogP | 5.12 |
| TPSA | 147.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.65 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|