C37H33FN6O4 — CID 177282515
(E)-3-[4-[[[2-[3-cyano-4-(4-cyano-3-fluorophenyl)-5-(3-hydroxy-4-methoxyphenyl)-2-pyridinyl]-2-azabicyclo[2.2.2]octan-5-yl]amino]methyl]phenyl]-N-hydroxyprop-2-enamide (PubChem CID 177282515) has the molecular formula C37H33FN6O4 and a molecular weight of 644.71 g/mol. Its IUPAC name is (E)-3-[4-[[[2-[3-cyano-4-(4-cyano-3-fluorophenyl)-5-(3-hydroxy-4-methoxyphenyl)-2-pyridinyl]-2-azabicyclo[2.2.2]octan-5-yl]amino]methyl]phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[4-[[[2-[3-cyano-4-(4-cyano-3-fluorophenyl)-5-(3-hydroxy-4-methoxyphenyl)-2-pyridinyl]-2-azabicyclo[2.2.2]octan-5-yl]amino]methyl]phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 177282515 |
| Molecular Formula | C37H33FN6O4 |
| Molecular Weight | 644.71 g/mol |
| Exact Mass | 644.25 |
| IUPAC Name | (E)-3-[4-[[[2-[3-cyano-4-(4-cyano-3-fluorophenyl)-5-(3-hydroxy-4-methoxyphenyl)-2-pyridinyl]-2-azabicyclo[2.2.2]octan-5-yl]amino]methyl]phenyl]-N-hydroxyprop-2-enamide |
| SMILES | COc1ccc(-c2cnc(N3CC4CCC3CC4NCc3ccc(/C=C/C(=O)NO)cc3)c(C#N)c2-c2ccc(C#N)c(F)c2)cc1O |
| InChI | InChI=1S/C37H33FN6O4/c1-48-34-12-10-24(15-33(34)45)30-20-42-37(29(18-40)36(30)25-7-8-26(17-39)31(38)14-25)44-21-27-9-11-28(44)16-32(27)41-19-23-4-2-22(3-5-23)6-13-35(46)43-47/h2-8,10,12-15,20,27-28,32,41,45,47H,9,11,16,19,21H2,1H3,(H,43,46)/b13-6+ |
| InChIKey | JWBRBJGKOHZYSG-AWNIVKPZSA-N |
| XLogP | 5.68 |
| TPSA | 154.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.71 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|