C35H32F2N6O4 — CID 177282583
3-[4-[[[1-[3-cyano-4-(4-cyano-3-fluorophenyl)-5-(3-hydroxy-4-methoxyphenyl)-2-pyridinyl]piperidin-4-yl]amino]methyl]-2-fluorophenyl]-N-hydroxypropanamide (PubChem CID 177282583) has the molecular formula C35H32F2N6O4 and a molecular weight of 638.68 g/mol. Its IUPAC name is 3-[4-[[[1-[3-cyano-4-(4-cyano-3-fluorophenyl)-5-(3-hydroxy-4-methoxyphenyl)-2-pyridinyl]piperidin-4-yl]amino]methyl]-2-fluorophenyl]-N-hydroxypropanamide.
| Compound Name | 3-[4-[[[1-[3-cyano-4-(4-cyano-3-fluorophenyl)-5-(3-hydroxy-4-methoxyphenyl)-2-pyridinyl]piperidin-4-yl]amino]methyl]-2-fluorophenyl]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 177282583 |
| Molecular Formula | C35H32F2N6O4 |
| Molecular Weight | 638.68 g/mol |
| Exact Mass | 638.25 |
| IUPAC Name | 3-[4-[[[1-[3-cyano-4-(4-cyano-3-fluorophenyl)-5-(3-hydroxy-4-methoxyphenyl)-2-pyridinyl]piperidin-4-yl]amino]methyl]-2-fluorophenyl]-N-hydroxypropanamide |
| SMILES | COc1ccc(-c2cnc(N3CCC(NCc4ccc(CCC(=O)NO)c(F)c4)CC3)c(C#N)c2-c2ccc(C#N)c(F)c2)cc1O |
| InChI | InChI=1S/C35H32F2N6O4/c1-47-32-8-6-23(16-31(32)44)28-20-41-35(27(18-39)34(28)24-4-5-25(17-38)30(37)15-24)43-12-10-26(11-13-43)40-19-21-2-3-22(29(36)14-21)7-9-33(45)42-46/h2-6,8,14-16,20,26,40,44,46H,7,9-13,19H2,1H3,(H,42,45) |
| InChIKey | KJDDLVZUCZDGQS-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 154.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.68 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|