C33H29FN8O4 — CID 177282493
(E)-3-[5-[[[1-[3-cyano-4-(4-cyano-3-fluorophenyl)-5-(4-hydroxy-3-methoxyphenyl)-2-pyridinyl]piperidin-4-yl]amino]methyl]pyrimidin-2-yl]-N-hydroxyprop-2-enamide (PubChem CID 177282493) has the molecular formula C33H29FN8O4 and a molecular weight of 620.65 g/mol. Its IUPAC name is (E)-3-[5-[[[1-[3-cyano-4-(4-cyano-3-fluorophenyl)-5-(4-hydroxy-3-methoxyphenyl)-2-pyridinyl]piperidin-4-yl]amino]methyl]pyrimidin-2-yl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[5-[[[1-[3-cyano-4-(4-cyano-3-fluorophenyl)-5-(4-hydroxy-3-methoxyphenyl)-2-pyridinyl]piperidin-4-yl]amino]methyl]pyrimidin-2-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 177282493 |
| Molecular Formula | C33H29FN8O4 |
| Molecular Weight | 620.65 g/mol |
| Exact Mass | 620.23 |
| IUPAC Name | (E)-3-[5-[[[1-[3-cyano-4-(4-cyano-3-fluorophenyl)-5-(4-hydroxy-3-methoxyphenyl)-2-pyridinyl]piperidin-4-yl]amino]methyl]pyrimidin-2-yl]-N-hydroxyprop-2-enamide |
| SMILES | COc1cc(-c2cnc(N3CCC(NCc4cnc(/C=C/C(=O)NO)nc4)CC3)c(C#N)c2-c2ccc(C#N)c(F)c2)ccc1O |
| InChI | InChI=1S/C33H29FN8O4/c1-46-29-13-21(4-5-28(29)43)26-19-40-33(25(15-36)32(26)22-2-3-23(14-35)27(34)12-22)42-10-8-24(9-11-42)37-16-20-17-38-30(39-18-20)6-7-31(44)41-45/h2-7,12-13,17-19,24,37,43,45H,8-11,16H2,1H3,(H,41,44)/b7-6+ |
| InChIKey | JIDRFGPRVMTCQJ-VOTSOKGWSA-N |
| XLogP | 4.08 |
| TPSA | 180.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.65 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|