C21H21N7O2 — CID 177284344
[4-(4-phenoxyanilino)-1H-pyrazolo[5,4-d]pyrimidin-6-yl]methyl N,N-dimethylcarbamimidate (PubChem CID 177284344) has the molecular formula C21H21N7O2 and a molecular weight of 403.45 g/mol. Its IUPAC name is [4-(4-phenoxyanilino)-1H-pyrazolo[5,4-d]pyrimidin-6-yl]methyl N,N-dimethylcarbamimidate.
| Compound Name | [4-(4-phenoxyanilino)-1H-pyrazolo[5,4-d]pyrimidin-6-yl]methyl N,N-dimethylcarbamimidate |
|---|---|
| PubChem CID | 177284344 |
| Molecular Formula | C21H21N7O2 |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | [4-(4-phenoxyanilino)-1H-pyrazolo[5,4-d]pyrimidin-6-yl]methyl N,N-dimethylcarbamimidate |
| SMILES | [H]/N=C(/OCc1nc(Nc2ccc(Oc3ccccc3)cc2)c2cn[nH]c2n1)N(C)C |
| InChI | InChI=1S/C21H21N7O2/c1-28(2)21(22)29-13-18-25-19(17-12-23-27-20(17)26-18)24-14-8-10-16(11-9-14)30-15-6-4-3-5-7-15/h3-12,22H,13H2,1-2H3,(H2,23,24,25,26,27)/b22-21+ |
| InChIKey | JPBZYQMFPSARIN-QURGRASLSA-N |
| XLogP | 3.90 |
| TPSA | 112.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|