C23H27N7O2 — CID 177284395
[4-amino-6-(4-phenoxyanilino)-1,3,5-triazin-2-yl]methyl N-methylpiperidine-1-carboximidate (PubChem CID 177284395) has the molecular formula C23H27N7O2 and a molecular weight of 433.52 g/mol. Its IUPAC name is [4-amino-6-(4-phenoxyanilino)-1,3,5-triazin-2-yl]methyl N-methylpiperidine-1-carboximidate.
| Compound Name | [4-amino-6-(4-phenoxyanilino)-1,3,5-triazin-2-yl]methyl N-methylpiperidine-1-carboximidate |
|---|---|
| PubChem CID | 177284395 |
| Molecular Formula | C23H27N7O2 |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | [4-amino-6-(4-phenoxyanilino)-1,3,5-triazin-2-yl]methyl N-methylpiperidine-1-carboximidate |
| SMILES | C/N=C(/OCc1nc(N)nc(Nc2ccc(Oc3ccccc3)cc2)n1)N1CCCCC1 |
| InChI | InChI=1S/C23H27N7O2/c1-25-23(30-14-6-3-7-15-30)31-16-20-27-21(24)29-22(28-20)26-17-10-12-19(13-11-17)32-18-8-4-2-5-9-18/h2,4-5,8-13H,3,6-7,14-16H2,1H3,(H3,24,26,27,28,29)/b25-23+ |
| InChIKey | FTQQQXJZGJATJF-WJTDDFOZSA-N |
| XLogP | 3.98 |
| TPSA | 110.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|