C16H12O — CID 177287228
8-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-2-ol (PubChem CID 177287228) has the molecular formula C16H12O and a molecular weight of 225.30 g/mol. Its IUPAC name is 8-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-2-ol.
| Compound Name | 8-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-2-ol |
|---|---|
| PubChem CID | 177287228 |
| Molecular Formula | C16H12O |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 8-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-2-ol |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cccc3ccc(O)cc23)c([2H])c1[2H] |
| InChI | InChI=1S/C16H12O/c17-14-10-9-13-7-4-8-15(16(13)11-14)12-5-2-1-3-6-12/h1-11,17H/i1D,2D,3D,5D,6D |
| InChIKey | CCSHLQBRNAHTIE-XFEWCBMOSA-N |
| XLogP | 4.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |