C39H46N4O10S2 — CID 177292671
2-[(4-butylphenyl)sulfonylamino]-5-[[(3S)-3-[[4-[(4-butylphenyl)sulfonylamino]-3-(dihydroxymethyl)benzoyl]amino]butanoyl]amino]benzoic acid (PubChem CID 177292671) has the molecular formula C39H46N4O10S2 and a molecular weight of 794.95 g/mol. Its IUPAC name is 2-[(4-butylphenyl)sulfonylamino]-5-[[(3S)-3-[[4-[(4-butylphenyl)sulfonylamino]-3-(dihydroxymethyl)benzoyl]amino]butanoyl]amino]benzoic acid.
| Compound Name | 2-[(4-butylphenyl)sulfonylamino]-5-[[(3S)-3-[[4-[(4-butylphenyl)sulfonylamino]-3-(dihydroxymethyl)benzoyl]amino]butanoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 177292671 |
| Molecular Formula | C39H46N4O10S2 |
| Molecular Weight | 794.95 g/mol |
| Exact Mass | 794.27 |
| IUPAC Name | 2-[(4-butylphenyl)sulfonylamino]-5-[[(3S)-3-[[4-[(4-butylphenyl)sulfonylamino]-3-(dihydroxymethyl)benzoyl]amino]butanoyl]amino]benzoic acid |
| SMILES | CCCCc1ccc(S(=O)(=O)Nc2ccc(NC(=O)C[C@H](C)NC(=O)c3ccc(NS(=O)(=O)c4ccc(CCCC)cc4)c(C(O)O)c3)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C39H46N4O10S2/c1-4-6-8-26-10-16-30(17-11-26)54(50,51)42-34-20-14-28(23-32(34)38(46)47)37(45)40-25(3)22-36(44)41-29-15-21-35(33(24-29)39(48)49)43-55(52,53)31-18-12-27(13-19-31)9-7-5-2/h10-21,23-25,38,42-43,46-47H,4-9,22H2,1-3H3,(H,40,45)(H,41,44)(H,48,49)/t25-/m0/s1 |
| InChIKey | IAEQDPYRBLWHGH-VWLOTQADSA-N |
| XLogP | 5.80 |
| TPSA | 228.30 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.95 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|