C11H16O4 — CID 177307533
(3R,4S)-3,4,8-trihydroxy-3-methyl-2,4,4a,5,6,7-hexahydronaphthalen-1-one (PubChem CID 177307533) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is (3R,4S)-3,4,8-trihydroxy-3-methyl-2,4,4a,5,6,7-hexahydronaphthalen-1-one.
| Compound Name | (3R,4S)-3,4,8-trihydroxy-3-methyl-2,4,4a,5,6,7-hexahydronaphthalen-1-one |
|---|---|
| PubChem CID | 177307533 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | (3R,4S)-3,4,8-trihydroxy-3-methyl-2,4,4a,5,6,7-hexahydronaphthalen-1-one |
| SMILES | C[C@@]1(O)CC(=O)C2=C(O)CCCC2[C@@H]1O |
| InChI | InChI=1S/C11H16O4/c1-11(15)5-8(13)9-6(10(11)14)3-2-4-7(9)12/h6,10,12,14-15H,2-5H2,1H3/t6?,10-,11+/m0/s1 |
| InChIKey | XAQJLVCZRQKVHC-YAPKUGLOSA-N |
| XLogP | 0.68 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |