C9H12O3 — CID 130031897
2-(3,3-dimethyloxiran-2-yl)-3-hydroxycyclopent-2-en-1-one (PubChem CID 130031897) has the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. Its IUPAC name is 2-(3,3-dimethyloxiran-2-yl)-3-hydroxycyclopent-2-en-1-one.
| Compound Name | 2-(3,3-dimethyloxiran-2-yl)-3-hydroxycyclopent-2-en-1-one |
|---|---|
| PubChem CID | 130031897 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 2-(3,3-dimethyloxiran-2-yl)-3-hydroxycyclopent-2-en-1-one |
| SMILES | CC1(C)OC1C1=C(O)CCC1=O |
| InChI | InChI=1S/C9H12O3/c1-9(2)8(12-9)7-5(10)3-4-6(7)11/h8,10H,3-4H2,1-2H3 |
| InChIKey | VFDGZNZMAOWCPL-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|