C11H7BCl3NO — CID 177314845
5,7-dichloro-2-cyano-3,4-dihydro-1H-2-benzoborinine-6-carbonyl chloride (PubChem CID 177314845) has the molecular formula C11H7BCl3NO and a molecular weight of 286.35 g/mol. Its IUPAC name is 5,7-dichloro-2-cyano-3,4-dihydro-1H-2-benzoborinine-6-carbonyl chloride.
| Compound Name | 5,7-dichloro-2-cyano-3,4-dihydro-1H-2-benzoborinine-6-carbonyl chloride |
|---|---|
| PubChem CID | 177314845 |
| Molecular Formula | C11H7BCl3NO |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 284.97 |
| IUPAC Name | 5,7-dichloro-2-cyano-3,4-dihydro-1H-2-benzoborinine-6-carbonyl chloride |
| SMILES | N#CB1CCc2c(cc(Cl)c(C(=O)Cl)c2Cl)C1 |
| InChI | InChI=1S/C11H7BCl3NO/c13-8-3-6-4-12(5-16)2-1-7(6)10(14)9(8)11(15)17/h3H,1-2,4H2 |
| InChIKey | DZZVGXVOVFTNON-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|