C32H30IN4O3- — CID 177319650
CID 177319650 (PubChem CID 177319650) has the molecular formula C32H30IN4O3- and a molecular weight of 645.52 g/mol.
| Compound Name | CID 177319650 |
|---|---|
| PubChem CID | 177319650 |
| Molecular Formula | C32H30IN4O3- |
| Molecular Weight | 645.52 g/mol |
| Exact Mass | 645.14 |
| IUPAC Name | — |
| SMILES | CC1=C[I-]C=C(CCCNC(=O)c2ccc(NC(=O)c3cc(-c4cccnc4)nc4c(C)cc(C)cc34)cc2)O1 |
| InChI | InChI=1S/C32H30IN4O3/c1-20-14-21(2)30-27(15-20)28(16-29(37-30)24-6-4-12-34-19-24)32(39)36-25-10-8-23(9-11-25)31(38)35-13-5-7-26-18-33-17-22(3)40-26/h4,6,8-12,14-19H,5,7,13H2,1-3H3,(H,35,38)(H,36,39)/q-1 |
| InChIKey | JIRLSLGRRBWTON-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.52 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|