C31H30N4O3 — CID 177320161
6,8-dimethyl-N-[4-[2-(2-methylprop-1-enoxy)prop-2-enylcarbamoyl]phenyl]-2-pyridin-3-ylquinoline-4-carboxamide (PubChem CID 177320161) has the molecular formula C31H30N4O3 and a molecular weight of 506.61 g/mol. Its IUPAC name is 6,8-dimethyl-N-[4-[2-(2-methylprop-1-enoxy)prop-2-enylcarbamoyl]phenyl]-2-pyridin-3-ylquinoline-4-carboxamide.
| Compound Name | 6,8-dimethyl-N-[4-[2-(2-methylprop-1-enoxy)prop-2-enylcarbamoyl]phenyl]-2-pyridin-3-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 177320161 |
| Molecular Formula | C31H30N4O3 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | 6,8-dimethyl-N-[4-[2-(2-methylprop-1-enoxy)prop-2-enylcarbamoyl]phenyl]-2-pyridin-3-ylquinoline-4-carboxamide |
| SMILES | C=C(CNC(=O)c1ccc(NC(=O)c2cc(-c3cccnc3)nc3c(C)cc(C)cc23)cc1)OC=C(C)C |
| InChI | InChI=1S/C31H30N4O3/c1-19(2)18-38-22(5)16-33-30(36)23-8-10-25(11-9-23)34-31(37)27-15-28(24-7-6-12-32-17-24)35-29-21(4)13-20(3)14-26(27)29/h6-15,17-18H,5,16H2,1-4H3,(H,33,36)(H,34,37) |
| InChIKey | NIEWPMBWXWKICC-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|