C30H29N5O3 — CID 177320068
N-[4-[[(Z)-5-amino-3-oxohex-4-enyl]carbamoyl]phenyl]-6,8-dimethyl-2-pyridin-3-ylquinoline-4-carboxamide (PubChem CID 177320068) has the molecular formula C30H29N5O3 and a molecular weight of 507.59 g/mol. Its IUPAC name is N-[4-[[(Z)-5-amino-3-oxohex-4-enyl]carbamoyl]phenyl]-6,8-dimethyl-2-pyridin-3-ylquinoline-4-carboxamide.
| Compound Name | N-[4-[[(Z)-5-amino-3-oxohex-4-enyl]carbamoyl]phenyl]-6,8-dimethyl-2-pyridin-3-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 177320068 |
| Molecular Formula | C30H29N5O3 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | N-[4-[[(Z)-5-amino-3-oxohex-4-enyl]carbamoyl]phenyl]-6,8-dimethyl-2-pyridin-3-ylquinoline-4-carboxamide |
| SMILES | C/C(N)=C/C(=O)CCNC(=O)c1ccc(NC(=O)c2cc(-c3cccnc3)nc3c(C)cc(C)cc23)cc1 |
| InChI | InChI=1S/C30H29N5O3/c1-18-13-19(2)28-25(14-18)26(16-27(35-28)22-5-4-11-32-17-22)30(38)34-23-8-6-21(7-9-23)29(37)33-12-10-24(36)15-20(3)31/h4-9,11,13-17H,10,12,31H2,1-3H3,(H,33,37)(H,34,38)/b20-15- |
| InChIKey | RGMCSQWXPMFLFV-HKWRFOASSA-N |
| XLogP | 4.72 |
| TPSA | 127.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|