C36H40N4O3 — CID 177320155
6,8-dimethyl-N-[4-[methyl-[6-methyl-5-[(Z)-prop-1-enoxy]hept-5-enyl]carbamoyl]phenyl]-2-pyridin-3-ylquinoline-4-carboxamide (PubChem CID 177320155) has the molecular formula C36H40N4O3 and a molecular weight of 576.74 g/mol. Its IUPAC name is 6,8-dimethyl-N-[4-[methyl-[6-methyl-5-[(Z)-prop-1-enoxy]hept-5-enyl]carbamoyl]phenyl]-2-pyridin-3-ylquinoline-4-carboxamide.
| Compound Name | 6,8-dimethyl-N-[4-[methyl-[6-methyl-5-[(Z)-prop-1-enoxy]hept-5-enyl]carbamoyl]phenyl]-2-pyridin-3-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 177320155 |
| Molecular Formula | C36H40N4O3 |
| Molecular Weight | 576.74 g/mol |
| Exact Mass | 576.31 |
| IUPAC Name | 6,8-dimethyl-N-[4-[methyl-[6-methyl-5-[(Z)-prop-1-enoxy]hept-5-enyl]carbamoyl]phenyl]-2-pyridin-3-ylquinoline-4-carboxamide |
| SMILES | C/C=C\OC(CCCCN(C)C(=O)c1ccc(NC(=O)c2cc(-c3cccnc3)nc3c(C)cc(C)cc23)cc1)=C(C)C |
| InChI | InChI=1S/C36H40N4O3/c1-7-19-43-33(24(2)3)12-8-9-18-40(6)36(42)27-13-15-29(16-14-27)38-35(41)31-22-32(28-11-10-17-37-23-28)39-34-26(5)20-25(4)21-30(31)34/h7,10-11,13-17,19-23H,8-9,12,18H2,1-6H3,(H,38,41)/b19-7- |
| InChIKey | DHUWFCWCDCCBHA-GXHLCREISA-N |
| XLogP | 8.25 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.74 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|