C33H33ClN4O3 — CID 177320138
2-(2-chlorophenyl)-6,8-dimethyl-N-[4-[methyl-[3-(propan-2-ylideneamino)oxybut-3-enyl]carbamoyl]phenyl]quinoline-4-carboxamide (PubChem CID 177320138) has the molecular formula C33H33ClN4O3 and a molecular weight of 569.11 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-6,8-dimethyl-N-[4-[methyl-[3-(propan-2-ylideneamino)oxybut-3-enyl]carbamoyl]phenyl]quinoline-4-carboxamide.
| Compound Name | 2-(2-chlorophenyl)-6,8-dimethyl-N-[4-[methyl-[3-(propan-2-ylideneamino)oxybut-3-enyl]carbamoyl]phenyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 177320138 |
| Molecular Formula | C33H33ClN4O3 |
| Molecular Weight | 569.11 g/mol |
| Exact Mass | 568.22 |
| IUPAC Name | 2-(2-chlorophenyl)-6,8-dimethyl-N-[4-[methyl-[3-(propan-2-ylideneamino)oxybut-3-enyl]carbamoyl]phenyl]quinoline-4-carboxamide |
| SMILES | C=C(CCN(C)C(=O)c1ccc(NC(=O)c2cc(-c3ccccc3Cl)nc3c(C)cc(C)cc23)cc1)ON=C(C)C |
| InChI | InChI=1S/C33H33ClN4O3/c1-20(2)37-41-23(5)15-16-38(6)33(40)24-11-13-25(14-12-24)35-32(39)28-19-30(26-9-7-8-10-29(26)34)36-31-22(4)17-21(3)18-27(28)31/h7-14,17-19H,5,15-16H2,1-4,6H3,(H,35,39) |
| InChIKey | YMHQSXUCKIPNMO-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.11 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|