C32H32ClN5O2 — CID 177319891
2-(2-chlorophenyl)-6,8-dimethyl-N-[4-[[(E)-C-methyl-N-[(E)-3-methylbutan-2-ylideneamino]carbonimidoyl]carbamoyl]phenyl]quinoline-4-carboxamide (PubChem CID 177319891) has the molecular formula C32H32ClN5O2 and a molecular weight of 554.09 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-6,8-dimethyl-N-[4-[[(E)-C-methyl-N-[(E)-3-methylbutan-2-ylideneamino]carbonimidoyl]carbamoyl]phenyl]quinoline-4-carboxamide.
| Compound Name | 2-(2-chlorophenyl)-6,8-dimethyl-N-[4-[[(E)-C-methyl-N-[(E)-3-methylbutan-2-ylideneamino]carbonimidoyl]carbamoyl]phenyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 177319891 |
| Molecular Formula | C32H32ClN5O2 |
| Molecular Weight | 554.09 g/mol |
| Exact Mass | 553.22 |
| IUPAC Name | 2-(2-chlorophenyl)-6,8-dimethyl-N-[4-[[(E)-C-methyl-N-[(E)-3-methylbutan-2-ylideneamino]carbonimidoyl]carbamoyl]phenyl]quinoline-4-carboxamide |
| SMILES | C/C(=N\N=C(/C)C(C)C)NC(=O)c1ccc(NC(=O)c2cc(-c3ccccc3Cl)nc3c(C)cc(C)cc23)cc1 |
| InChI | InChI=1S/C32H32ClN5O2/c1-18(2)21(5)37-38-22(6)34-31(39)23-11-13-24(14-12-23)35-32(40)27-17-29(25-9-7-8-10-28(25)33)36-30-20(4)15-19(3)16-26(27)30/h7-18H,1-6H3,(H,35,40)(H,34,38,39)/b37-21+ |
| InChIKey | SCRBYKDUFUDVFP-FDALDRLYSA-N |
| XLogP | 7.60 |
| TPSA | 95.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.09 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|