C33H32N4O3 — CID 177319699
N-[4-[(2-aminocyclohexene-1-carbonyl)carbamoyl]phenyl]-6,8-dimethyl-2-(2-methylphenyl)quinoline-4-carboxamide (PubChem CID 177319699) has the molecular formula C33H32N4O3 and a molecular weight of 532.64 g/mol. Its IUPAC name is N-[4-[(2-aminocyclohexene-1-carbonyl)carbamoyl]phenyl]-6,8-dimethyl-2-(2-methylphenyl)quinoline-4-carboxamide.
| Compound Name | N-[4-[(2-aminocyclohexene-1-carbonyl)carbamoyl]phenyl]-6,8-dimethyl-2-(2-methylphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 177319699 |
| Molecular Formula | C33H32N4O3 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | N-[4-[(2-aminocyclohexene-1-carbonyl)carbamoyl]phenyl]-6,8-dimethyl-2-(2-methylphenyl)quinoline-4-carboxamide |
| SMILES | Cc1cc(C)c2nc(-c3ccccc3C)cc(C(=O)Nc3ccc(C(=O)NC(=O)C4=C(N)CCCC4)cc3)c2c1 |
| InChI | InChI=1S/C33H32N4O3/c1-19-16-21(3)30-26(17-19)27(18-29(36-30)24-9-5-4-8-20(24)2)33(40)35-23-14-12-22(13-15-23)31(38)37-32(39)25-10-6-7-11-28(25)34/h4-5,8-9,12-18H,6-7,10-11,34H2,1-3H3,(H,35,40)(H,37,38,39) |
| InChIKey | JUSAPVDHVNTJLG-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|