C32H29ClN4O3 — CID 177320262
2-(2-chlorophenyl)-6,8-dimethyl-N-[4-[3-(5-methyl-1,3-oxazol-2-yl)propylcarbamoyl]phenyl]quinoline-4-carboxamide (PubChem CID 177320262) has the molecular formula C32H29ClN4O3 and a molecular weight of 553.06 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-6,8-dimethyl-N-[4-[3-(5-methyl-1,3-oxazol-2-yl)propylcarbamoyl]phenyl]quinoline-4-carboxamide.
| Compound Name | 2-(2-chlorophenyl)-6,8-dimethyl-N-[4-[3-(5-methyl-1,3-oxazol-2-yl)propylcarbamoyl]phenyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 177320262 |
| Molecular Formula | C32H29ClN4O3 |
| Molecular Weight | 553.06 g/mol |
| Exact Mass | 552.19 |
| IUPAC Name | 2-(2-chlorophenyl)-6,8-dimethyl-N-[4-[3-(5-methyl-1,3-oxazol-2-yl)propylcarbamoyl]phenyl]quinoline-4-carboxamide |
| SMILES | Cc1cc(C)c2nc(-c3ccccc3Cl)cc(C(=O)Nc3ccc(C(=O)NCCCc4ncc(C)o4)cc3)c2c1 |
| InChI | InChI=1S/C32H29ClN4O3/c1-19-15-20(2)30-25(16-19)26(17-28(37-30)24-7-4-5-8-27(24)33)32(39)36-23-12-10-22(11-13-23)31(38)34-14-6-9-29-35-18-21(3)40-29/h4-5,7-8,10-13,15-18H,6,9,14H2,1-3H3,(H,34,38)(H,36,39) |
| InChIKey | CWPUOTGVVNFQFG-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.06 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|