C16H20F2 — CID 177325844
1-[(3E,5Z)-5,6-difluoroocta-3,5-dien-3-yl]-3,5-dimethylbenzene (PubChem CID 177325844) has the molecular formula C16H20F2 and a molecular weight of 250.33 g/mol. Its IUPAC name is 1-[(3E,5Z)-5,6-difluoroocta-3,5-dien-3-yl]-3,5-dimethylbenzene.
| Compound Name | 1-[(3E,5Z)-5,6-difluoroocta-3,5-dien-3-yl]-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 177325844 |
| Molecular Formula | C16H20F2 |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 1-[(3E,5Z)-5,6-difluoroocta-3,5-dien-3-yl]-3,5-dimethylbenzene |
| SMILES | CC/C(F)=C(F)\C=C(/CC)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C16H20F2/c1-5-13(10-16(18)15(17)6-2)14-8-11(3)7-12(4)9-14/h7-10H,5-6H2,1-4H3/b13-10+,16-15- |
| InChIKey | OOMPWSWARNIACJ-XMQQHHPKSA-N |
| XLogP | 5.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|