C29H30O6 — CID 177327518
2,3-dihydro-1H-inden-2-yl (4S)-2,4-bis(2-methoxyphenyl)cyclobutane-1-carboxylate;formic acid (PubChem CID 177327518) has the molecular formula C29H30O6 and a molecular weight of 474.55 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-2-yl (4S)-2,4-bis(2-methoxyphenyl)cyclobutane-1-carboxylate;formic acid.
| Compound Name | 2,3-dihydro-1H-inden-2-yl (4S)-2,4-bis(2-methoxyphenyl)cyclobutane-1-carboxylate;formic acid |
|---|---|
| PubChem CID | 177327518 |
| Molecular Formula | C29H30O6 |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | 2,3-dihydro-1H-inden-2-yl (4S)-2,4-bis(2-methoxyphenyl)cyclobutane-1-carboxylate;formic acid |
| SMILES | COc1ccccc1C1C[C@H](c2ccccc2OC)C1C(=O)OC1Cc2ccccc2C1.O=CO |
| InChI | InChI=1S/C28H28O4.CH2O2/c1-30-25-13-7-5-11-21(25)23-17-24(22-12-6-8-14-26(22)31-2)27(23)28(29)32-20-15-18-9-3-4-10-19(18)16-20;2-1-3/h3-14,20,23-24,27H,15-17H2,1-2H3;1H,(H,2,3)/t23-,24?,27?;/m1./s1 |
| InChIKey | JHRVNEPVEARWSD-IHGTUNQVSA-N |
| XLogP | 5.00 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|