C17H22N2O3 — CID 177334561
butyl 3-[1-(2-methoxyphenyl)ethyl]imidazole-4-carboxylate (PubChem CID 177334561) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is butyl 3-[1-(2-methoxyphenyl)ethyl]imidazole-4-carboxylate.
| Compound Name | butyl 3-[1-(2-methoxyphenyl)ethyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 177334561 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | butyl 3-[1-(2-methoxyphenyl)ethyl]imidazole-4-carboxylate |
| SMILES | CCCCOC(=O)c1cncn1C(C)c1ccccc1OC |
| InChI | InChI=1S/C17H22N2O3/c1-4-5-10-22-17(20)15-11-18-12-19(15)13(2)14-8-6-7-9-16(14)21-3/h6-9,11-13H,4-5,10H2,1-3H3 |
| InChIKey | BLXQWISHFXDJAX-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|