C50H96N4O5S2 — CID 177335750
[(Z)-non-2-enyl] 8-[4-[[4-[2-(diethylamino)ethyl-methylamino]-3-(methylamino)-4-oxobutyl]disulfanyl]butyl-[8-[(Z)-non-2-enoxy]-8-oxooctyl]amino]octanoate (PubChem CID 177335750) has the molecular formula C50H96N4O5S2 and a molecular weight of 897.47 g/mol. Its IUPAC name is [(Z)-non-2-enyl] 8-[4-[[4-[2-(diethylamino)ethyl-methylamino]-3-(methylamino)-4-oxobutyl]disulfanyl]butyl-[8-[(Z)-non-2-enoxy]-8-oxooctyl]amino]octanoate.
| Compound Name | [(Z)-non-2-enyl] 8-[4-[[4-[2-(diethylamino)ethyl-methylamino]-3-(methylamino)-4-oxobutyl]disulfanyl]butyl-[8-[(Z)-non-2-enoxy]-8-oxooctyl]amino]octanoate |
|---|---|
| PubChem CID | 177335750 |
| Molecular Formula | C50H96N4O5S2 |
| Molecular Weight | 897.47 g/mol |
| Exact Mass | 896.68 |
| IUPAC Name | [(Z)-non-2-enyl] 8-[4-[[4-[2-(diethylamino)ethyl-methylamino]-3-(methylamino)-4-oxobutyl]disulfanyl]butyl-[8-[(Z)-non-2-enoxy]-8-oxooctyl]amino]octanoate |
| SMILES | CCCCCC/C=C\COC(=O)CCCCCCCN(CCCCCCCC(=O)OC/C=C\CCCCCC)CCCCSSCCC(NC)C(=O)N(C)CCN(CC)CC |
| InChI | InChI=1S/C50H96N4O5S2/c1-7-11-13-15-17-25-32-43-58-48(55)35-27-21-19-23-29-38-54(39-30-24-20-22-28-36-49(56)59-44-33-26-18-16-14-12-8-2)40-31-34-45-60-61-46-37-47(51-5)50(57)52(6)41-42-53(9-3)10-4/h25-26,32-33,47,51H,7-24,27-31,34-46H2,1-6H3/b32-25-,33-26- |
| InChIKey | CWPCXJXXSSIKBK-MKHSXDCDSA-N |
| XLogP | 12.05 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 897.47 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|