C16H22N3NaO2S — CID 177336232
sodium;tert-butyl N-cyclopentylcarbamate;2H-[1,3]thiazolo[5,4-b]pyridin-2-ide (PubChem CID 177336232) has the molecular formula C16H22N3NaO2S and a molecular weight of 343.43 g/mol. Its IUPAC name is sodium;tert-butyl N-cyclopentylcarbamate;2H-[1,3]thiazolo[5,4-b]pyridin-2-ide.
| Compound Name | sodium;tert-butyl N-cyclopentylcarbamate;2H-[1,3]thiazolo[5,4-b]pyridin-2-ide |
|---|---|
| PubChem CID | 177336232 |
| Molecular Formula | C16H22N3NaO2S |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | sodium;tert-butyl N-cyclopentylcarbamate;2H-[1,3]thiazolo[5,4-b]pyridin-2-ide |
| SMILES | CC(C)(C)OC(=O)NC1CCCC1.[Na+].[c-]1nc2cccnc2s1 |
| InChI | InChI=1S/C10H19NO2.C6H3N2S.Na/c1-10(2,3)13-9(12)11-8-6-4-5-7-8;1-2-5-6(7-3-1)9-4-8-5;/h8H,4-7H2,1-3H3,(H,11,12);1-3H;/q;-1;+1 |
| InChIKey | NFRBUBQOUWKGRS-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|