C44H50N6 — CID 177339022
(2E)-1-[4-[1-[1-[1-[4-(2,6-dimethylidenepiperidin-3-yl)phenyl]piperidin-4-yl]pyrrol-3-yl]ethyl]phenyl]-2-(2-imino-2-phenylethylidene)pyrrol-3-imine;ethane (PubChem CID 177339022) has the molecular formula C44H50N6 and a molecular weight of 662.93 g/mol. Its IUPAC name is (2E)-1-[4-[1-[1-[1-[4-(2,6-dimethylidenepiperidin-3-yl)phenyl]piperidin-4-yl]pyrrol-3-yl]ethyl]phenyl]-2-(2-imino-2-phenylethylidene)pyrrol-3-imine;ethane.
| Compound Name | (2E)-1-[4-[1-[1-[1-[4-(2,6-dimethylidenepiperidin-3-yl)phenyl]piperidin-4-yl]pyrrol-3-yl]ethyl]phenyl]-2-(2-imino-2-phenylethylidene)pyrrol-3-imine;ethane |
|---|---|
| PubChem CID | 177339022 |
| Molecular Formula | C44H50N6 |
| Molecular Weight | 662.93 g/mol |
| Exact Mass | 662.41 |
| IUPAC Name | (2E)-1-[4-[1-[1-[1-[4-(2,6-dimethylidenepiperidin-3-yl)phenyl]piperidin-4-yl]pyrrol-3-yl]ethyl]phenyl]-2-(2-imino-2-phenylethylidene)pyrrol-3-imine;ethane |
| SMILES | CC.[H]/N=C(/C=C1C(=N\[H])\C=CN\1c1ccc(C(C)c2ccn(C3CCN(c4ccc(C5CCC(=C)NC5=C)cc4)CC3)c2)cc1)c1ccccc1 |
| InChI | InChI=1S/C42H44N6.C2H6/c1-29-9-18-39(31(3)45-29)33-12-14-36(15-13-33)46-24-20-37(21-25-46)47-23-19-35(28-47)30(2)32-10-16-38(17-11-32)48-26-22-40(43)42(48)27-41(44)34-7-5-4-6-8-34;1-2/h4-8,10-17,19,22-23,26-28,30,37,39,43-45H,1,3,9,18,20-21,24-25H2,2H3;1-2H3/b42-27+,43-40+,44-41-; |
| InChIKey | JLCNNVBVYBRSRP-WWLGNKMPSA-N |
| XLogP | 10.31 |
| TPSA | 71.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.93 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|