C16H25N3O2 — CID 177339100
(4E)-3-imino-N,7-dimethyl-4-[1-(methylamino)ethenyl]-2-(3-oxopropyl)octa-4,6-dienamide (PubChem CID 177339100) has the molecular formula C16H25N3O2 and a molecular weight of 291.39 g/mol. Its IUPAC name is (4E)-3-imino-N,7-dimethyl-4-[1-(methylamino)ethenyl]-2-(3-oxopropyl)octa-4,6-dienamide.
| Compound Name | (4E)-3-imino-N,7-dimethyl-4-[1-(methylamino)ethenyl]-2-(3-oxopropyl)octa-4,6-dienamide |
|---|---|
| PubChem CID | 177339100 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | (4E)-3-imino-N,7-dimethyl-4-[1-(methylamino)ethenyl]-2-(3-oxopropyl)octa-4,6-dienamide |
| SMILES | [H]/N=C(C(=C/C=C(C)C)/C(=C)NC)\C(CCC=O)C(=O)NC |
| InChI | InChI=1S/C16H25N3O2/c1-11(2)8-9-13(12(3)18-4)15(17)14(7-6-10-20)16(21)19-5/h8-10,14,17-18H,3,6-7H2,1-2,4-5H3,(H,19,21)/b13-9+,17-15- |
| InChIKey | JHNUCNYWWWBMON-UYVUBNSVSA-N |
| XLogP | 1.97 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|