C9H17N3O2 — CID 177340464
(5S)-8-(2-hydroxyethyl)-2,6,8-triazaspiro[4.5]decan-7-one (PubChem CID 177340464) has the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. Its IUPAC name is (5S)-8-(2-hydroxyethyl)-2,6,8-triazaspiro[4.5]decan-7-one.
| Compound Name | (5S)-8-(2-hydroxyethyl)-2,6,8-triazaspiro[4.5]decan-7-one |
|---|---|
| PubChem CID | 177340464 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | (5S)-8-(2-hydroxyethyl)-2,6,8-triazaspiro[4.5]decan-7-one |
| SMILES | O=C1N[C@@]2(CCNC2)CCN1CCO |
| InChI | InChI=1S/C9H17N3O2/c13-6-5-12-4-2-9(11-8(12)14)1-3-10-7-9/h10,13H,1-7H2,(H,11,14)/t9-/m0/s1 |
| InChIKey | QHSDLBYWFLTGOL-VIFPVBQESA-N |
| XLogP | -0.87 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |