C21H33NO8 — CID 177341707
2-[2-[2-[[(6S,8aR)-7,8-dimethoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]ethoxy]ethoxy]ethanamine (PubChem CID 177341707) has the molecular formula C21H33NO8 and a molecular weight of 427.49 g/mol. Its IUPAC name is 2-[2-[2-[[(6S,8aR)-7,8-dimethoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]ethoxy]ethoxy]ethanamine.
| Compound Name | 2-[2-[2-[[(6S,8aR)-7,8-dimethoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]ethoxy]ethoxy]ethanamine |
|---|---|
| PubChem CID | 177341707 |
| Molecular Formula | C21H33NO8 |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | 2-[2-[2-[[(6S,8aR)-7,8-dimethoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]ethoxy]ethoxy]ethanamine |
| SMILES | COC1C(OC)[C@@H]2OC(c3ccccc3)OCC2O[C@@H]1OCCOCCOCCN |
| InChI | InChI=1S/C21H33NO8/c1-23-18-17-16(14-28-20(30-17)15-6-4-3-5-7-15)29-21(19(18)24-2)27-13-12-26-11-10-25-9-8-22/h3-7,16-21H,8-14,22H2,1-2H3/t16?,17-,18?,19?,20?,21+/m1/s1 |
| InChIKey | VKSUNDKPMNIVIF-HVGSZJOFSA-N |
| XLogP | 0.86 |
| TPSA | 99.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|