C35H58F3NO6 — CID 177345504
3-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-2-[[(Z)-1,1,1-trifluorononadec-12-en-2-yl]amino]propanoic acid (PubChem CID 177345504) has the molecular formula C35H58F3NO6 and a molecular weight of 645.84 g/mol. Its IUPAC name is 3-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-2-[[(Z)-1,1,1-trifluorononadec-12-en-2-yl]amino]propanoic acid.
| Compound Name | 3-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-2-[[(Z)-1,1,1-trifluorononadec-12-en-2-yl]amino]propanoic acid |
|---|---|
| PubChem CID | 177345504 |
| Molecular Formula | C35H58F3NO6 |
| Molecular Weight | 645.84 g/mol |
| Exact Mass | 645.42 |
| IUPAC Name | 3-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-2-[[(Z)-1,1,1-trifluorononadec-12-en-2-yl]amino]propanoic acid |
| SMILES | CCCCCC/C=C\CCCCCCCCCC(NC(Cc1ccc(OCCOCCOCCOC)cc1)C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C35H58F3NO6/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-33(35(36,37)38)39-32(34(40)41)29-30-19-21-31(22-20-30)45-28-27-44-26-25-43-24-23-42-2/h8-9,19-22,32-33,39H,3-7,10-18,23-29H2,1-2H3,(H,40,41)/b9-8- |
| InChIKey | GNOSHQHKUMRMAD-HJWRWDBZSA-N |
| XLogP | 8.30 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.84 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|