C41H69NO8 — CID 144573626
tert-butyl (E,2S)-2-(2-methoxyethyl)-12-oxononadec-4-enoate;methyl (2S)-3-(4-butoxyphenyl)-2-formamidopropanoate (PubChem CID 144573626) has the molecular formula C41H69NO8 and a molecular weight of 704.00 g/mol. Its IUPAC name is tert-butyl (E,2S)-2-(2-methoxyethyl)-12-oxononadec-4-enoate;methyl (2S)-3-(4-butoxyphenyl)-2-formamidopropanoate.
| Compound Name | tert-butyl (E,2S)-2-(2-methoxyethyl)-12-oxononadec-4-enoate;methyl (2S)-3-(4-butoxyphenyl)-2-formamidopropanoate |
|---|---|
| PubChem CID | 144573626 |
| Molecular Formula | C41H69NO8 |
| Molecular Weight | 704.00 g/mol |
| Exact Mass | 703.50 |
| IUPAC Name | tert-butyl (E,2S)-2-(2-methoxyethyl)-12-oxononadec-4-enoate;methyl (2S)-3-(4-butoxyphenyl)-2-formamidopropanoate |
| SMILES | CCCCCCCC(=O)CCCCCC/C=C/C[C@@H](CCOC)C(=O)OC(C)(C)C.CCCCOc1ccc(C[C@H](NC=O)C(=O)OC)cc1 |
| InChI | InChI=1S/C26H48O4.C15H21NO4/c1-6-7-8-12-16-19-24(27)20-17-14-11-9-10-13-15-18-23(21-22-29-5)25(28)30-26(2,3)4;1-3-4-9-20-13-7-5-12(6-8-13)10-14(16-11-17)15(18)19-2/h13,15,23H,6-12,14,16-22H2,1-5H3;5-8,11,14H,3-4,9-10H2,1-2H3,(H,16,17)/b15-13+;/t23-;14-/m00/s1 |
| InChIKey | QADKCQHXBDPPOY-QLMFUXDUSA-N |
| XLogP | 8.89 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.00 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|