C40H65NO9 — CID 118157393
(E,2S,3R)-2-[(4-butoxyphenyl)methyl]-3-carbamoyl-3-[(2S)-2-hydroxy-4-methoxy-1-[(2-methylpropan-2-yl)oxy]-1-oxobutan-2-yl]-12-oxononadec-4-enoic acid (PubChem CID 118157393) has the molecular formula C40H65NO9 and a molecular weight of 703.96 g/mol. Its IUPAC name is (E,2S,3R)-2-[(4-butoxyphenyl)methyl]-3-carbamoyl-3-[(2S)-2-hydroxy-4-methoxy-1-[(2-methylpropan-2-yl)oxy]-1-oxobutan-2-yl]-12-oxononadec-4-enoic acid.
| Compound Name | (E,2S,3R)-2-[(4-butoxyphenyl)methyl]-3-carbamoyl-3-[(2S)-2-hydroxy-4-methoxy-1-[(2-methylpropan-2-yl)oxy]-1-oxobutan-2-yl]-12-oxononadec-4-enoic acid |
|---|---|
| PubChem CID | 118157393 |
| Molecular Formula | C40H65NO9 |
| Molecular Weight | 703.96 g/mol |
| Exact Mass | 703.47 |
| IUPAC Name | (E,2S,3R)-2-[(4-butoxyphenyl)methyl]-3-carbamoyl-3-[(2S)-2-hydroxy-4-methoxy-1-[(2-methylpropan-2-yl)oxy]-1-oxobutan-2-yl]-12-oxononadec-4-enoic acid |
| SMILES | CCCCCCCC(=O)CCCCCC/C=C/[C@@](C(N)=O)([C@H](Cc1ccc(OCCCC)cc1)C(=O)O)[C@@](O)(CCOC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C40H65NO9/c1-7-9-11-14-17-20-32(42)21-18-15-12-13-16-19-26-39(36(41)45,40(47,27-29-48-6)37(46)50-38(3,4)5)34(35(43)44)30-31-22-24-33(25-23-31)49-28-10-8-2/h19,22-26,34,47H,7-18,20-21,27-30H2,1-6H3,(H2,41,45)(H,43,44)/b26-19+/t34-,39+,40-/m1/s1 |
| InChIKey | HISCWKKDIHOZQA-GSRPOIKASA-N |
| XLogP | 7.52 |
| TPSA | 162.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.96 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|