C37H60N2O8 — CID 118157925
(E,2S,3S)-3-[2-(4-butoxyphenyl)ethyl-(methylcarbamoyl)carbamoyl]-2-hydroxy-2-(2-methoxyethyl)-12-oxononadec-4-enoic acid (PubChem CID 118157925) has the molecular formula C37H60N2O8 and a molecular weight of 660.89 g/mol. Its IUPAC name is (E,2S,3S)-3-[2-(4-butoxyphenyl)ethyl-(methylcarbamoyl)carbamoyl]-2-hydroxy-2-(2-methoxyethyl)-12-oxononadec-4-enoic acid.
| Compound Name | (E,2S,3S)-3-[2-(4-butoxyphenyl)ethyl-(methylcarbamoyl)carbamoyl]-2-hydroxy-2-(2-methoxyethyl)-12-oxononadec-4-enoic acid |
|---|---|
| PubChem CID | 118157925 |
| Molecular Formula | C37H60N2O8 |
| Molecular Weight | 660.89 g/mol |
| Exact Mass | 660.43 |
| IUPAC Name | (E,2S,3S)-3-[2-(4-butoxyphenyl)ethyl-(methylcarbamoyl)carbamoyl]-2-hydroxy-2-(2-methoxyethyl)-12-oxononadec-4-enoic acid |
| SMILES | CCCCCCCC(=O)CCCCCC/C=C/[C@H](C(=O)N(CCc1ccc(OCCCC)cc1)C(=O)NC)[C@@](O)(CCOC)C(=O)O |
| InChI | InChI=1S/C37H60N2O8/c1-5-7-9-12-15-18-31(40)19-16-13-10-11-14-17-20-33(37(45,35(42)43)26-29-46-4)34(41)39(36(44)38-3)27-25-30-21-23-32(24-22-30)47-28-8-6-2/h17,20-24,33,45H,5-16,18-19,25-29H2,1-4H3,(H,38,44)(H,42,43)/b20-17+/t33-,37+/m1/s1 |
| InChIKey | DIHMSUNKDXLGAJ-LWSDIOHWSA-N |
| XLogP | 6.87 |
| TPSA | 142.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.89 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|