C40H67NO8 — CID 144573669
(2S)-3-(4-butoxyphenyl)-2-formamidopropanoic acid;tert-butyl (E,2S)-2-(2-methoxyethyl)-12-oxononadec-4-enoate (PubChem CID 144573669) has the molecular formula C40H67NO8 and a molecular weight of 689.98 g/mol. Its IUPAC name is (2S)-3-(4-butoxyphenyl)-2-formamidopropanoic acid;tert-butyl (E,2S)-2-(2-methoxyethyl)-12-oxononadec-4-enoate.
| Compound Name | (2S)-3-(4-butoxyphenyl)-2-formamidopropanoic acid;tert-butyl (E,2S)-2-(2-methoxyethyl)-12-oxononadec-4-enoate |
|---|---|
| PubChem CID | 144573669 |
| Molecular Formula | C40H67NO8 |
| Molecular Weight | 689.98 g/mol |
| Exact Mass | 689.49 |
| IUPAC Name | (2S)-3-(4-butoxyphenyl)-2-formamidopropanoic acid;tert-butyl (E,2S)-2-(2-methoxyethyl)-12-oxononadec-4-enoate |
| SMILES | CCCCCCCC(=O)CCCCCC/C=C/C[C@@H](CCOC)C(=O)OC(C)(C)C.CCCCOc1ccc(C[C@H](NC=O)C(=O)O)cc1 |
| InChI | InChI=1S/C26H48O4.C14H19NO4/c1-6-7-8-12-16-19-24(27)20-17-14-11-9-10-13-15-18-23(21-22-29-5)25(28)30-26(2,3)4;1-2-3-8-19-12-6-4-11(5-7-12)9-13(14(17)18)15-10-16/h13,15,23H,6-12,14,16-22H2,1-5H3;4-7,10,13H,2-3,8-9H2,1H3,(H,15,16)(H,17,18)/b15-13+;/t23-;13-/m00/s1 |
| InChIKey | YRPSMQXTQMJPSN-FDGSBWTDSA-N |
| XLogP | 8.80 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.98 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|