C22H40O3 — CID 144573528
(E,2S)-2-(2-methoxyethyl)-12-oxononadec-4-enal (PubChem CID 144573528) has the molecular formula C22H40O3 and a molecular weight of 352.56 g/mol. Its IUPAC name is (E,2S)-2-(2-methoxyethyl)-12-oxononadec-4-enal.
| Compound Name | (E,2S)-2-(2-methoxyethyl)-12-oxononadec-4-enal |
|---|---|
| PubChem CID | 144573528 |
| Molecular Formula | C22H40O3 |
| Molecular Weight | 352.56 g/mol |
| Exact Mass | 352.30 |
| IUPAC Name | (E,2S)-2-(2-methoxyethyl)-12-oxononadec-4-enal |
| SMILES | CCCCCCCC(=O)CCCCCC/C=C/C[C@H](C=O)CCOC |
| InChI | InChI=1S/C22H40O3/c1-3-4-5-9-13-16-22(24)17-14-11-8-6-7-10-12-15-21(20-23)18-19-25-2/h10,12,20-21H,3-9,11,13-19H2,1-2H3/b12-10+/t21-/m0/s1 |
| InChIKey | KPIHZYHAQNQWIF-ACUNGTFPSA-N |
| XLogP | 6.05 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.56 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|