C22H40O5 — CID 118182212
(E,2R)-2-hydroxy-2-(2-methoxyethyl)-12-oxononadec-4-enoic acid (PubChem CID 118182212) has the molecular formula C22H40O5 and a molecular weight of 384.56 g/mol. Its IUPAC name is (E,2R)-2-hydroxy-2-(2-methoxyethyl)-12-oxononadec-4-enoic acid.
| Compound Name | (E,2R)-2-hydroxy-2-(2-methoxyethyl)-12-oxononadec-4-enoic acid |
|---|---|
| PubChem CID | 118182212 |
| Molecular Formula | C22H40O5 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.29 |
| IUPAC Name | (E,2R)-2-hydroxy-2-(2-methoxyethyl)-12-oxononadec-4-enoic acid |
| SMILES | CCCCCCCC(=O)CCCCCC/C=C/C[C@@](O)(CCOC)C(=O)O |
| InChI | InChI=1S/C22H40O5/c1-3-4-5-9-12-15-20(23)16-13-10-7-6-8-11-14-17-22(26,21(24)25)18-19-27-2/h11,14,26H,3-10,12-13,15-19H2,1-2H3,(H,24,25)/b14-11+/t22-/m1/s1 |
| InChIKey | LAKYSFDQTNKKKC-YDYPUGOESA-N |
| XLogP | 5.06 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|