C56H97NO8 — CID 177352701
tridecan-7-yl 8-[butyl-[6-[2-(9,13-dimethyl-16-oxo-6-propyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-8-yl)-2-oxoethoxy]-6-oxohexyl]amino]octanoate (PubChem CID 177352701) has the molecular formula C56H97NO8 and a molecular weight of 912.39 g/mol. Its IUPAC name is tridecan-7-yl 8-[butyl-[6-[2-(9,13-dimethyl-16-oxo-6-propyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-8-yl)-2-oxoethoxy]-6-oxohexyl]amino]octanoate.
| Compound Name | tridecan-7-yl 8-[butyl-[6-[2-(9,13-dimethyl-16-oxo-6-propyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-8-yl)-2-oxoethoxy]-6-oxohexyl]amino]octanoate |
|---|---|
| PubChem CID | 177352701 |
| Molecular Formula | C56H97NO8 |
| Molecular Weight | 912.39 g/mol |
| Exact Mass | 911.72 |
| IUPAC Name | tridecan-7-yl 8-[butyl-[6-[2-(9,13-dimethyl-16-oxo-6-propyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-8-yl)-2-oxoethoxy]-6-oxohexyl]amino]octanoate |
| SMILES | CCCCCCC(CCCCCC)OC(=O)CCCCCCCN(CCCC)CCCCCC(=O)OCC(=O)C12OC(CCC)OC1CC1C3CCC4CC(=O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C56H97NO8/c1-7-11-14-20-27-45(28-21-15-12-8-2)63-52(61)30-22-17-16-18-24-38-57(37-13-9-3)39-25-19-23-29-51(60)62-42-49(59)56-50(64-53(65-56)26-10-4)41-48-46-32-31-43-40-44(58)33-35-54(43,5)47(46)34-36-55(48,56)6/h43,45-48,50,53H,7-42H2,1-6H3 |
| InChIKey | IKMMCJRKEAJXPZ-UHFFFAOYSA-N |
| XLogP | 13.46 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 912.39 |
| LogP ≤ 5 | 13.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|