C17H26ClN3O — CID 177354348
3-chloro-N,N-dimethyl-4-(1,2,3,6-tetrahydropyridin-4-yl)benzamide;ethene;methanamine (PubChem CID 177354348) has the molecular formula C17H26ClN3O and a molecular weight of 323.87 g/mol. Its IUPAC name is 3-chloro-N,N-dimethyl-4-(1,2,3,6-tetrahydropyridin-4-yl)benzamide;ethene;methanamine.
| Compound Name | 3-chloro-N,N-dimethyl-4-(1,2,3,6-tetrahydropyridin-4-yl)benzamide;ethene;methanamine |
|---|---|
| PubChem CID | 177354348 |
| Molecular Formula | C17H26ClN3O |
| Molecular Weight | 323.87 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | 3-chloro-N,N-dimethyl-4-(1,2,3,6-tetrahydropyridin-4-yl)benzamide;ethene;methanamine |
| SMILES | C=C.CN.CN(C)C(=O)c1ccc(C2=CCNCC2)c(Cl)c1 |
| InChI | InChI=1S/C14H17ClN2O.C2H4.CH5N/c1-17(2)14(18)11-3-4-12(13(15)9-11)10-5-7-16-8-6-10;2*1-2/h3-5,9,16H,6-8H2,1-2H3;1-2H2;2H2,1H3 |
| InChIKey | QWPNSPIWOJGPPC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.87 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|