C22H36FN3O4 — CID 177372285
N-[[(2S,4R)-4-(3-aminopropoxy)-1-ethylpyrrolidin-2-yl]methyl]-5-(3-fluoropropyl)-2,3-dimethoxybenzamide (PubChem CID 177372285) has the molecular formula C22H36FN3O4 and a molecular weight of 425.55 g/mol. Its IUPAC name is N-[[(2S,4R)-4-(3-aminopropoxy)-1-ethylpyrrolidin-2-yl]methyl]-5-(3-fluoropropyl)-2,3-dimethoxybenzamide.
| Compound Name | N-[[(2S,4R)-4-(3-aminopropoxy)-1-ethylpyrrolidin-2-yl]methyl]-5-(3-fluoropropyl)-2,3-dimethoxybenzamide |
|---|---|
| PubChem CID | 177372285 |
| Molecular Formula | C22H36FN3O4 |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.27 |
| IUPAC Name | N-[[(2S,4R)-4-(3-aminopropoxy)-1-ethylpyrrolidin-2-yl]methyl]-5-(3-fluoropropyl)-2,3-dimethoxybenzamide |
| SMILES | CCN1C[C@H](OCCCN)C[C@H]1CNC(=O)c1cc(CCCF)cc(OC)c1OC |
| InChI | InChI=1S/C22H36FN3O4/c1-4-26-15-18(30-10-6-9-24)13-17(26)14-25-22(27)19-11-16(7-5-8-23)12-20(28-2)21(19)29-3/h11-12,17-18H,4-10,13-15,24H2,1-3H3,(H,25,27)/t17-,18+/m0/s1 |
| InChIKey | QODHNMBBWHFBBL-ZWKOTPCHSA-N |
| XLogP | 2.16 |
| TPSA | 86.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|