C22H41N3O3 — CID 142289009
5-(4-aminobutyl)-2,3-dimethoxy-N-methylbenzamide;ethane;1-ethylpyrrolidine (PubChem CID 142289009) has the molecular formula C22H41N3O3 and a molecular weight of 395.59 g/mol. Its IUPAC name is 5-(4-aminobutyl)-2,3-dimethoxy-N-methylbenzamide;ethane;1-ethylpyrrolidine.
| Compound Name | 5-(4-aminobutyl)-2,3-dimethoxy-N-methylbenzamide;ethane;1-ethylpyrrolidine |
|---|---|
| PubChem CID | 142289009 |
| Molecular Formula | C22H41N3O3 |
| Molecular Weight | 395.59 g/mol |
| Exact Mass | 395.31 |
| IUPAC Name | 5-(4-aminobutyl)-2,3-dimethoxy-N-methylbenzamide;ethane;1-ethylpyrrolidine |
| SMILES | CC.CCN1CCCC1.CNC(=O)c1cc(CCCCN)cc(OC)c1OC |
| InChI | InChI=1S/C14H22N2O3.C6H13N.C2H6/c1-16-14(17)11-8-10(6-4-5-7-15)9-12(18-2)13(11)19-3;1-2-7-5-3-4-6-7;1-2/h8-9H,4-7,15H2,1-3H3,(H,16,17);2-6H2,1H3;1-2H3 |
| InChIKey | NEMACSTWPPQNPR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.59 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|