C17H28N2O5 — CID 142289008
5-[3-[2-(2-aminoethoxy)ethoxy]propyl]-2,3-dimethoxy-N-methylbenzamide (PubChem CID 142289008) has the molecular formula C17H28N2O5 and a molecular weight of 340.42 g/mol. Its IUPAC name is 5-[3-[2-(2-aminoethoxy)ethoxy]propyl]-2,3-dimethoxy-N-methylbenzamide.
| Compound Name | 5-[3-[2-(2-aminoethoxy)ethoxy]propyl]-2,3-dimethoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 142289008 |
| Molecular Formula | C17H28N2O5 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 5-[3-[2-(2-aminoethoxy)ethoxy]propyl]-2,3-dimethoxy-N-methylbenzamide |
| SMILES | CNC(=O)c1cc(CCCOCCOCCN)cc(OC)c1OC |
| InChI | InChI=1S/C17H28N2O5/c1-19-17(20)14-11-13(12-15(21-2)16(14)22-3)5-4-7-23-9-10-24-8-6-18/h11-12H,4-10,18H2,1-3H3,(H,19,20) |
| InChIKey | GVZDERMHQFOKRX-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|