C23H36FN3O4 — CID 177372290
N-[[(2R,4S)-4-(3-aminopropoxy)-1-prop-2-enylpyrrolidin-2-yl]methyl]-5-(3-fluoropropyl)-2,3-dimethoxybenzamide (PubChem CID 177372290) has the molecular formula C23H36FN3O4 and a molecular weight of 437.56 g/mol. Its IUPAC name is N-[[(2R,4S)-4-(3-aminopropoxy)-1-prop-2-enylpyrrolidin-2-yl]methyl]-5-(3-fluoropropyl)-2,3-dimethoxybenzamide.
| Compound Name | N-[[(2R,4S)-4-(3-aminopropoxy)-1-prop-2-enylpyrrolidin-2-yl]methyl]-5-(3-fluoropropyl)-2,3-dimethoxybenzamide |
|---|---|
| PubChem CID | 177372290 |
| Molecular Formula | C23H36FN3O4 |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | N-[[(2R,4S)-4-(3-aminopropoxy)-1-prop-2-enylpyrrolidin-2-yl]methyl]-5-(3-fluoropropyl)-2,3-dimethoxybenzamide |
| SMILES | C=CCN1C[C@@H](OCCCN)C[C@@H]1CNC(=O)c1cc(CCCF)cc(OC)c1OC |
| InChI | InChI=1S/C23H36FN3O4/c1-4-10-27-16-19(31-11-6-9-25)14-18(27)15-26-23(28)20-12-17(7-5-8-24)13-21(29-2)22(20)30-3/h4,12-13,18-19H,1,5-11,14-16,25H2,2-3H3,(H,26,28)/t18-,19+/m1/s1 |
| InChIKey | TZDYPFYPZGPSPS-MOPGFXCFSA-N |
| XLogP | 2.33 |
| TPSA | 86.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|