C21H20O7 — CID 177375408
(9S)-6,8,9,11-tetrahydroxy-4-methoxy-3,9-dimethyl-8,10-dihydro-7H-tetracene-5,12-dione (PubChem CID 177375408) has the molecular formula C21H20O7 and a molecular weight of 384.38 g/mol. Its IUPAC name is (9S)-6,8,9,11-tetrahydroxy-4-methoxy-3,9-dimethyl-8,10-dihydro-7H-tetracene-5,12-dione.
| Compound Name | (9S)-6,8,9,11-tetrahydroxy-4-methoxy-3,9-dimethyl-8,10-dihydro-7H-tetracene-5,12-dione |
|---|---|
| PubChem CID | 177375408 |
| Molecular Formula | C21H20O7 |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | (9S)-6,8,9,11-tetrahydroxy-4-methoxy-3,9-dimethyl-8,10-dihydro-7H-tetracene-5,12-dione |
| SMILES | COc1c(C)ccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)C[C@](C)(O)C(O)C3 |
| InChI | InChI=1S/C21H20O7/c1-8-4-5-9-13(20(8)28-3)19(26)15-14(16(9)23)18(25)11-7-21(2,27)12(22)6-10(11)17(15)24/h4-5,12,22,24-25,27H,6-7H2,1-3H3/t12?,21-/m0/s1 |
| InChIKey | GSGHKPVESIEVSW-FHQWGVRCSA-N |
| XLogP | 1.40 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|